CAS 1160573-20-5

4-Chloro-3,5-difluorobenzaldehyde

Description:

4-Chloro-3,5-difluorobenzaldehyde is an aromatic aldehyde characterized by the presence of a benzene ring substituted with a chlorine atom and two fluorine atoms at the 3 and 5 positions, along with an aldehyde functional group at the 1 position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its reactivity due to the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic addition and condensation reactions. The presence of electronegative halogen atoms (chlorine and fluorine) influences its electronic properties, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its unique substitution pattern can impart specific physical properties, such as increased polarity and potential for hydrogen bonding. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental concerns.

Formula: C₇H₃ClF₂O

InChI: InChI=1S/C7H3ClF2O/c8-7-5(9)1-4(3-11)2-6(7)10/h1-3H

InChI key: InChIKey=RFARYBRXGROFNC-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(F)=C(Cl)C(F)=C1

Synonyms:

• 4-Chloro-3,5-difluorobenzaldehyde
• Benzaldehyde, 4-chloro-3,5-difluoro-

Benzaldehyde, 4-chloro-3,5-difluoro-

CAS: 1160573-20-5

Formula: C₇H₃ClF₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.5479

Ref: IN-DA000BHW

4-Chloro-3,5-difluorobenzaldehyde

CAS: 1160573-20-5

4-Chloro-3,5-difluorobenzaldehyde

Formula: C₇H₃ClF₂O

Purity: 97%

Color and Shape: white fused solid

Molecular weight: 176.54792g/mol

Ref: 54-PC302574

4-Chloro-3,5-difluorobenzaldehyde

CAS: 1160573-20-5

Formula: C₇H₃ClF₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.55

Ref: 10-F343354

4-Chloro-3,5-difluorobenzaldehyde

Controlled Product

CAS: 1160573-20-5

Formula: C₇H₃ClF₂O

Color and Shape: Neat

Molecular weight: 176.548

Ref: TR-C365960