
CAS 1160573-30-7
:3,4-Dibromo-6-chloro-2-fluorobenzoic acid
Description:
3,4-Dibromo-6-chloro-2-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of multiple halogen substituents on its benzene ring. Specifically, it features two bromine atoms, one chlorine atom, and one fluorine atom, which significantly influence its chemical properties and reactivity. The presence of these halogens can enhance the compound's lipophilicity and alter its electronic characteristics, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. Additionally, the compound may exhibit interesting biological activities due to its halogenated structure, which can affect interactions with biological targets. Its synthesis typically involves halogenation reactions followed by carboxylation processes. Safety and handling precautions are essential due to the potential toxicity of halogenated compounds. Overall, 3,4-Dibromo-6-chloro-2-fluorobenzoic acid is a complex molecule with unique properties that warrant further investigation for its applications in various fields.
Formula:C7H2Br2ClFO2
InChI:InChI=1S/C7H2Br2ClFO2/c8-2-1-3(10)4(7(12)13)6(11)5(2)9/h1H,(H,12,13)
InChI key:InChIKey=QURNCQBTZOBERF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C(Br)=C(Br)C=C1Cl
Synonyms:- 3,4-Dibromo-6-chloro-2-fluorobenzoic acid
- Benzoic acid, 3,4-dibromo-6-chloro-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.