CAS 1160573-40-9

2,3-Dibromo-6-fluoro-5-iodobenzoic acid

Description:

2,3-Dibromo-6-fluoro-5-iodobenzoic acid is a halogenated aromatic compound characterized by the presence of multiple halogen substituents on a benzoic acid framework. This compound features two bromine atoms, one fluorine atom, and one iodine atom attached to the benzene ring, which significantly influences its chemical reactivity and physical properties. The presence of these halogens can enhance the compound's lipophilicity and alter its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. Additionally, the specific arrangement of the halogens can affect the compound's steric hindrance and molecular interactions, which are critical for its biological activity. As with many halogenated compounds, it may exhibit unique reactivity patterns, such as electrophilic substitution or nucleophilic attack, depending on the reaction conditions. Safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds.

Formula: C₇H₂Br₂FIO₂

InChI: InChI=1S/C7H2Br2FIO2/c8-2-1-3(11)6(10)4(5(2)9)7(12)13/h1H,(H,12,13)

InChI key: InChIKey=NLKXWPPBJQEQDR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)C(Br)=CC(I)=C1F

Synonyms:

• Benzoic acid, 2,3-dibromo-6-fluoro-5-iodo-
• 2,3-Dibromo-6-fluoro-5-iodobenzoic acid