CymitQuimica logo

CAS 1160573-43-2

:

1-Bromo-4-iodo-2,3-dimethylbenzene

Description:
1-Bromo-4-iodo-2,3-dimethylbenzene is an aromatic compound characterized by the presence of both bromine and iodine substituents on a dimethylbenzene framework. This compound features a benzene ring with two methyl groups located at the 2 and 3 positions, a bromine atom at the 1 position, and an iodine atom at the 4 position. The presence of these halogen atoms introduces significant reactivity, particularly in nucleophilic substitution reactions, and can influence the compound's physical properties, such as boiling and melting points. The steric hindrance from the methyl groups may also affect its reactivity and interaction with other chemical species. Additionally, the compound's halogen substituents can enhance its utility in various organic synthesis applications, including the development of pharmaceuticals and agrochemicals. As with many halogenated compounds, it is important to handle 1-bromo-4-iodo-2,3-dimethylbenzene with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C8H8BrI
InChI:InChI=1S/C8H8BrI/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,1-2H3
InChI key:LXCPAICQHCSLQE-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1C)I)Br
Found 4 products.