CAS 1160573-45-4

3,5-Dibromo-2-fluoro-6-iodobenzoic acid

Description:

3,5-Dibromo-2-fluoro-6-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of multiple halogen substituents on its benzene ring. Specifically, it features two bromine atoms at the 3 and 5 positions, a fluorine atom at the 2 position, and an iodine atom at the 6 position, which significantly influences its chemical properties and reactivity. The presence of these halogens can enhance the compound's polarity and affect its solubility in various solvents. As a benzoic acid derivative, it possesses a carboxylic acid functional group, which contributes to its acidic properties. This compound may exhibit interesting biological activities due to its halogenated structure, making it a potential candidate for pharmaceutical applications. Additionally, the presence of multiple halogens can also impact its stability and reactivity in organic synthesis, making it useful in various chemical reactions. Overall, 3,5-Dibromo-2-fluoro-6-iodobenzoic acid is a complex molecule with unique characteristics stemming from its halogen substitutions.

Formula: C₇H₂Br₂FIO₂

InChI: InChI=1S/C7H2Br2FIO2/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1H,(H,12,13)

InChI key: InChIKey=POGCJUZEBDDFMR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)C(Br)=CC(Br)=C1I

Synonyms:

• Benzoic acid, 3,5-dibromo-2-fluoro-6-iodo-
• 3,5-Dibromo-2-fluoro-6-iodobenzoic acid