CAS 1160573-61-4

1-Bromo-4-chloro-5-methyl-2-nitrobenzene

Description:

1-Bromo-4-chloro-5-methyl-2-nitrobenzene is an aromatic compound characterized by the presence of multiple functional groups attached to a benzene ring. It features a bromine atom, a chlorine atom, a methyl group, and a nitro group, which contribute to its chemical reactivity and physical properties. The presence of the nitro group typically imparts significant electron-withdrawing characteristics, influencing the compound's reactivity in electrophilic aromatic substitution reactions. The bromine and chlorine substituents can also participate in various chemical reactions, such as nucleophilic substitution or cross-coupling reactions. This compound is likely to be a solid at room temperature, with a specific melting point and boiling point that reflect its molecular structure. Its solubility in organic solvents may vary, and it may exhibit moderate toxicity, necessitating careful handling. Overall, 1-Bromo-4-chloro-5-methyl-2-nitrobenzene serves as a useful intermediate in organic synthesis and may find applications in pharmaceuticals, agrochemicals, or materials science.

Formula: C₇H₅BrClNO₂

InChI: InChI=1S/C7H5BrClNO2/c1-4-2-5(8)7(10(11)12)3-6(4)9/h2-3H,1H3

InChI key: InChIKey=SJHVPHZZWINMDW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Br)C=C(C)C(Cl)=C1

Synonyms:

• Benzene, 1-bromo-4-chloro-5-methyl-2-nitro-
• 1-Bromo-4-chloro-5-methyl-2-nitrobenzene