CymitQuimica logo

CAS 1160573-67-0

:

1-Bromo-3-chloro-2,5-difluorobenzene

Description:
1-Bromo-3-chloro-2,5-difluorobenzene is an aromatic halogenated compound characterized by the presence of bromine, chlorine, and fluorine substituents on a benzene ring. The molecular structure features a bromine atom at the first position, a chlorine atom at the third position, and two fluorine atoms at the second and fifth positions, contributing to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of multiple halogens can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, the compound's halogen substituents can influence its physical properties, such as boiling point and solubility, as well as its environmental behavior, including persistence and bioaccumulation potential. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.
Formula:C6H2BrClF2
InChI:InChI=1S/C6H2BrClF2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H
InChI key:InChIKey=ZXJZOLQKJFVXSE-UHFFFAOYSA-N
SMILES:FC1=C(Br)C=C(F)C=C1Cl
Synonyms:
  • 1-Bromo-3-chloro-2,5-difluorobenzene
  • Benzene, 1-bromo-3-chloro-2,5-difluoro-
Found 4 products.