CAS 1160573-75-0
:1,3-Dibromo-2-iodo-5-methyl-4-nitrobenzene
Description:
1,3-Dibromo-2-iodo-5-methyl-4-nitrobenzene is an organic compound characterized by its complex halogenated aromatic structure. It features two bromine atoms and one iodine atom attached to a benzene ring, along with a methyl group and a nitro group, which contribute to its chemical reactivity and physical properties. The presence of multiple halogens typically enhances the compound's reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The nitro group introduces electron-withdrawing characteristics, influencing the compound's electrophilicity and potential interactions in chemical reactions. Additionally, the methyl group can affect the steric hindrance and solubility of the compound. This substance may exhibit distinct physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular forces. Due to its halogen content, it may also have implications for environmental and health safety, necessitating careful handling and disposal. Overall, 1,3-Dibromo-2-iodo-5-methyl-4-nitrobenzene is a notable compound in the realm of synthetic organic chemistry.
Formula:C7H4Br2INO2
InChI:InChI=1S/C7H4Br2INO2/c1-3-2-4(8)6(10)5(9)7(3)11(12)13/h2H,1H3
InChI key:InChIKey=VHRMPMPSCJDAPI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(Br)C(I)=C(Br)C=C1C
Synonyms:- Benzene, 1,3-dibromo-2-iodo-5-methyl-4-nitro-
- 1,3-Dibromo-2-iodo-5-methyl-4-nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
