CymitQuimica logo

CAS 1160573-77-2

:

1,5-Dibromo-2-chloro-3-ethylbenzene

Description:
1,5-Dibromo-2-chloro-3-ethylbenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms, one chlorine atom, and one ethyl group. The presence of multiple halogen substituents contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure suggests that it may exhibit significant hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. The presence of halogens can also impart unique properties, such as increased density and potential biological activity. Safety considerations are important when handling this compound, as halogenated organic compounds can be toxic and environmentally hazardous. Proper storage and disposal methods should be followed to mitigate any risks associated with its use.
Formula:C8H7Br2Cl
InChI:InChI=1S/C8H7Br2Cl/c1-2-5-3-6(9)4-7(10)8(5)11/h3-4H,2H2,1H3
InChI key:InChIKey=QTASKJLZXKVSCK-UHFFFAOYSA-N
SMILES:C(C)C1=C(Cl)C(Br)=CC(Br)=C1
Synonyms:
  • Benzene, 1,5-dibromo-2-chloro-3-ethyl-
  • 1,5-Dibromo-2-chloro-3-ethylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.