CAS 1160573-79-4
:1,3-Dibromo-2-chloro-5-(difluoromethoxy)benzene
Description:
1,3-Dibromo-2-chloro-5-(difluoromethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms, one chlorine atom, and a difluoromethoxy group. The presence of multiple halogen substituents contributes to its potential reactivity and influences its physical properties, such as boiling and melting points. The difluoromethoxy group introduces both electronegative fluorine atoms and an ether functionality, which can enhance the compound's polarity and solubility in various solvents. This compound may exhibit interesting biological activities due to its halogenated nature, making it of interest in fields such as medicinal chemistry and materials science. Additionally, the specific arrangement of substituents on the benzene ring can affect its electronic properties, potentially leading to applications in organic electronics or as a precursor in synthetic chemistry. Safety and handling considerations are important due to the presence of halogens, which can pose environmental and health risks.
Formula:C7H3Br2ClF2O
InChI:InChI=1S/C7H3Br2ClF2O/c8-4-1-3(13-7(11)12)2-5(9)6(4)10/h1-2,7H
InChI key:InChIKey=CNYUMFXKDDOMFQ-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC(Br)=C(Cl)C(Br)=C1
Synonyms:- Benzene, 1,3-dibromo-2-chloro-5-(difluoromethoxy)-
- 1,3-Dibromo-2-chloro-5-(difluoromethoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.