
CAS 1160574-25-3
:1,5-Dibromo-2-chloro-3,4-difluorobenzene
Description:
1,5-Dibromo-2-chloro-3,4-difluorobenzene is a halogenated aromatic compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features two bromine atoms, one chlorine atom, and two fluorine atoms attached to the aromatic system. This compound is typically a colorless to pale yellow solid at room temperature, exhibiting a relatively high melting point due to the strong intermolecular forces associated with the halogen substituents. The presence of these electronegative halogens contributes to its chemical reactivity, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. Additionally, the compound's structure may influence its solubility in organic solvents and its behavior in chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Due to the presence of multiple halogens, it may also exhibit unique properties such as increased stability and potential environmental persistence. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.
Formula:C6HBr2ClF2
InChI:InChI=1S/C6HBr2ClF2/c7-2-1-3(8)5(10)6(11)4(2)9/h1H
InChI key:InChIKey=IUVQNZOZJXHTQX-UHFFFAOYSA-N
SMILES:ClC1=C(F)C(F)=C(Br)C=C1Br
Synonyms:- 1,5-Dibromo-2-chloro-3,4-difluorobenzene
- Benzene, 1,5-dibromo-2-chloro-3,4-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.