CAS 1160574-33-3
:3-Bromo-2,5-dichlorobenzonitrile
Description:
3-Bromo-2,5-dichlorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with bromine and chlorine atoms, as well as a nitrile functional group. The presence of these halogen substituents contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitrile and halogen groups. Additionally, the compound's physical properties, such as melting point and boiling point, are influenced by the arrangement and type of substituents on the benzene ring. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 3-Bromo-2,5-dichlorobenzonitrile is a significant compound in synthetic organic chemistry with various potential applications.
Formula:C7H2BrCl2N
InChI:InChI=1S/C7H2BrCl2N/c8-6-2-5(9)1-4(3-11)7(6)10/h1-2H
InChI key:InChIKey=PWTKUSJMSXLWML-UHFFFAOYSA-N
SMILES:C(#N)C1=C(Cl)C(Br)=CC(Cl)=C1
Synonyms:- Benzonitrile, 3-bromo-2,5-dichloro-
- 3-Bromo-2,5-dichlorobenzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
