
CAS 1160574-34-4
:2,4-Dibromo-1,3-dichloro-5-fluorobenzene
Description:
2,4-Dibromo-1,3-dichloro-5-fluorobenzene is a halogenated aromatic compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features two bromine atoms, two chlorine atoms, and one fluorine atom attached to the aromatic system. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as color and melting point, which can vary based on purity and specific conditions. The presence of multiple halogens suggests that it may have significant reactivity, particularly in nucleophilic substitution reactions. Additionally, the compound may be of interest in various applications, including as an intermediate in organic synthesis or in the study of environmental chemistry due to its potential persistence and bioaccumulation. Safety considerations are important, as halogenated compounds can be toxic and may pose environmental hazards. Proper handling and disposal methods should be employed to mitigate risks associated with exposure.
Formula:C6HBr2Cl2F
InChI:InChI=1S/C6HBr2Cl2F/c7-4-2(9)1-3(11)5(8)6(4)10/h1H
InChI key:InChIKey=SFMSSZCTWYRRKL-UHFFFAOYSA-N
SMILES:BrC1=C(Cl)C(Br)=C(F)C=C1Cl
Synonyms:- 2,4-Dibromo-1,3-dichloro-5-fluorobenzene
- Benzene, 2,4-dibromo-1,3-dichloro-5-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.