CAS 1160574-39-9

Benzonitrile, 2-bromo-3,5-dichloro-

Description:

Benzonitrile, 2-bromo-3,5-dichloro- is an organic compound characterized by the presence of a benzonitrile group, which consists of a benzene ring attached to a nitrile (-CN) functional group. The specific structure includes bromine and chlorine substituents at the 2, 3, and 5 positions of the benzene ring, contributing to its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of halogens can influence its chemical behavior, making it more reactive in nucleophilic substitution reactions. Additionally, the compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₇H₂BrCl₂N

InChI: InChI=1S/C7H2BrCl2N/c8-7-4(3-11)1-5(9)2-6(7)10/h1-2H

InChI key: InChIKey=WFUAPOVDTWFIDN-UHFFFAOYSA-N

SMILES: C(#N)C1=C(Br)C(Cl)=CC(Cl)=C1

Synonyms:

• Benzonitrile, 2-bromo-3,5-dichloro-
• 2-Bromo-3,5-dichlorobenzonitrile

2-Bromo-3,5-dichlorobenzonitrile

CAS: 1160574-39-9

2-Bromo-3,5-dichlorobenzonitrile

Purity: 95%

Molecular weight: 250.91g/mol

Ref: 54-OR1045196