CAS 1160574-41-3

3,5-Dichloro-2-iodobenzonitrile

Description:

3,5-Dichloro-2-iodobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms and one iodine atom, as well as a nitrile functional group (-C≡N). The presence of these halogen substituents contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent properties. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitrile group and the halogens. Additionally, the compound's halogen atoms can influence its physical properties, such as melting point and boiling point, as well as its overall stability. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₇H₂Cl₂IN

InChI: InChI=1S/C7H2Cl2IN/c8-5-1-4(3-11)7(10)6(9)2-5/h1-2H

InChI key: InChIKey=KJGFZBLKRSRUCX-UHFFFAOYSA-N

SMILES: C(#N)C1=C(I)C(Cl)=CC(Cl)=C1

Synonyms:

• Benzonitrile, 3,5-dichloro-2-iodo-
• 3,5-Dichloro-2-iodobenzonitrile