CAS 1160574-53-7
:1,5-Dibromo-2-chloro-4-fluoro-3-methylbenzene
Description:
1,5-Dibromo-2-chloro-4-fluoro-3-methylbenzene is an aromatic compound characterized by the presence of multiple halogen substituents and a methyl group on a benzene ring. The compound features two bromine atoms, one chlorine atom, and one fluorine atom, which contribute to its reactivity and physical properties. The presence of these halogens typically enhances the compound's lipophilicity and can influence its boiling and melting points, making it more soluble in organic solvents. The methyl group introduces steric effects that can affect the compound's reactivity and interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as an intermediate in chemical reactions. Additionally, the presence of multiple halogens can impart unique electronic properties, making it a candidate for studies in reactivity and stability under different conditions. Safety and handling precautions are essential due to the toxic nature of halogenated compounds.
Formula:C7H4Br2ClF
InChI:InChI=1S/C7H4Br2ClF/c1-3-6(10)4(8)2-5(9)7(3)11/h2H,1H3
InChI key:InChIKey=OUVSLFYCIBQCES-UHFFFAOYSA-N
SMILES:ClC1=C(C)C(F)=C(Br)C=C1Br
Synonyms:- Benzene, 1,5-dibromo-2-chloro-4-fluoro-3-methyl-
- 1,5-Dibromo-2-chloro-4-fluoro-3-methylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.