CAS 1160574-59-3
:Methyl 3,4-dibromo-5-fluorobenzoate
Description:
Methyl 3,4-dibromo-5-fluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with bromine and fluorine atoms. The presence of two bromine atoms at the 3 and 4 positions and a fluorine atom at the 5 position on the benzene ring contributes to its unique chemical properties, including increased reactivity and potential for various chemical transformations. The methyl ester functional group enhances its solubility in organic solvents, making it useful in synthetic applications. This compound may exhibit biological activity due to its halogenated structure, which can influence interactions with biological targets. Additionally, the presence of multiple halogens can affect its stability and reactivity, making it a candidate for further studies in medicinal chemistry or materials science. As with many halogenated compounds, considerations regarding environmental impact and toxicity are important, particularly in terms of persistence and bioaccumulation. Overall, Methyl 3,4-dibromo-5-fluorobenzoate is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H5Br2FO2
InChI:InChI=1S/C8H5Br2FO2/c1-13-8(12)4-2-5(9)7(10)6(11)3-4/h2-3H,1H3
InChI key:InChIKey=ZUGVWVIIXVUUPI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(Br)=C(Br)C(F)=C1
Synonyms:- Benzoic acid, 3,4-dibromo-5-fluoro-, methyl ester
- Methyl 3,4-dibromo-5-fluorobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
