
CAS 1160574-63-9
:1,3-Dibromo-2,5-dichloro-4-fluorobenzene
Description:
1,3-Dibromo-2,5-dichloro-4-fluorobenzene is an aromatic halogenated compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features two bromine atoms, two chlorine atoms, and one fluorine atom attached to the aromatic system. This compound is typically a solid at room temperature and may exhibit a crystalline structure. Its molecular structure contributes to its chemical stability and potential reactivity, particularly in nucleophilic substitution reactions due to the presence of the electron-withdrawing halogen atoms. The compound may have applications in various fields, including organic synthesis and materials science, due to its unique electronic properties and potential as an intermediate in the synthesis of more complex molecules. Additionally, the presence of multiple halogens can influence its solubility, boiling point, and melting point, making it of interest in both industrial and research contexts. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.
Formula:C6HBr2Cl2F
InChI:InChI=1S/C6HBr2Cl2F/c7-2-1-3(9)6(11)4(8)5(2)10/h1H
InChI key:InChIKey=IXZJIALQMVUMIN-UHFFFAOYSA-N
SMILES:ClC1=C(Br)C(F)=C(Cl)C=C1Br
Synonyms:- 1,3-Dibromo-2,5-dichloro-4-fluorobenzene
- Benzene, 1,3-dibromo-2,5-dichloro-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.