CAS 1160574-83-3

Ethyl 3,4-dibromo-5-chlorobenzoate

Description:

Ethyl 3,4-dibromo-5-chlorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with bromine and chlorine atoms. The presence of the ethyl ester group contributes to its solubility in organic solvents, while the halogen substituents can influence its reactivity and potential applications in synthesis. This compound is typically a solid at room temperature and may exhibit a distinct color, depending on its purity and specific structural features. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to the reactivity of the halogen atoms. Additionally, the presence of multiple halogens can enhance its biological activity or alter its physical properties, making it a subject of interest in various chemical research fields. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.

Formula: C₉H₇Br₂ClO₂

InChI: InChI=1S/C9H7Br2ClO2/c1-2-14-9(13)5-3-6(10)8(11)7(12)4-5/h3-4H,2H2,1H3

InChI key: InChIKey=NDQVOMSACBVPJP-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC(Br)=C(Br)C(Cl)=C1

Synonyms:

• Ethyl 3,4-dibromo-5-chlorobenzoate
• Benzoic acid, 3,4-dibromo-5-chloro-, ethyl ester