CymitQuimica logo

CAS 1160574-86-6

:

2,4-Dibromo-6-chloro-3-methoxybenzenamine

Description:
2,4-Dibromo-6-chloro-3-methoxybenzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms, one chlorine atom, and a methoxy group, as well as an amino group. The presence of these halogen substituents typically influences the compound's reactivity, solubility, and potential biological activity. The methoxy group can enhance the compound's lipophilicity, affecting its interaction with biological membranes. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmaceutical applications, depending on its specific reactivity and interactions. Additionally, the presence of multiple halogens suggests that it may have applications in materials science or as a precursor in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds. Overall, 2,4-Dibromo-6-chloro-3-methoxybenzenamine is a complex molecule with diverse potential applications in various fields of chemistry.
Formula:C7H6Br2ClNO
InChI:InChI=1S/C7H6Br2ClNO/c1-12-7-3(8)2-4(10)6(11)5(7)9/h2H,11H2,1H3
InChI key:InChIKey=DGRWPNLLMWGCGK-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)C(N)=C(Cl)C=C1Br
Synonyms:
  • 2,4-Dibromo-6-chloro-3-methoxybenzenamine
  • 2,4-Dibromo-6-chloro-3-methoxyaniline
  • Benzenamine, 2,4-dibromo-6-chloro-3-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.