CAS 116060-93-6

7-Hydroxy-7-phenylfuro[3,4-b]pyridin-5(7H)-one

Description:

7-Hydroxy-7-phenylfuro[3,4-b]pyridin-5(7H)-one, with the CAS number 116060-93-6, is a chemical compound that features a fused ring system comprising a furan and pyridine moiety. This compound is characterized by the presence of a hydroxyl group (-OH) and a phenyl group attached to the furo-pyridine structure, which contributes to its potential biological activity. The molecular structure suggests that it may exhibit properties such as antioxidant activity, and it could be of interest in medicinal chemistry for its potential therapeutic applications. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Its unique structural features may also influence its interaction with biological targets, making it a candidate for further research in drug development and pharmacology. As with many organic compounds, safety and handling precautions should be observed when working with this substance in a laboratory setting.

Formula: C₁₃H₉NO₃

InChI: InChI=1S/C13H9NO3/c15-12-10-7-4-8-14-11(10)13(16,17-12)9-5-2-1-3-6-9/h1-8,16H

InChI key: InChIKey=KDDUDLAYGQZGOG-UHFFFAOYSA-N

SMILES: OC1(C=2C(C(=O)O1)=CC=CN2)C3=CC=CC=C3

Synonyms:

• Furo[3,4-b]pyridin-5(7H)-one, 7-hydroxy-7-phenyl-
• 7-Hydroxy-7-phenylfuro[3,4-b]pyridin-5(7H)-one

Furo[3,4-b]pyridin-5(7H)-one, 7-hydroxy-7-phenyl-

CAS: 116060-93-6

Formula: C₁₃H₉NO₃

Molecular weight: 227.2155

Ref: IN-DA000BIN