CAS 1160623-39-1

2-Fluoro-4-nitrobenzeneacetaldehyde

Description:

2-Fluoro-4-nitrobenzeneacetaldehyde is an organic compound characterized by the presence of a fluorine atom and a nitro group on a benzene ring, along with an aldehyde functional group. Its molecular structure features a benzene ring substituted at the 2-position with a fluorine atom and at the 4-position with a nitro group, while the acetaldehyde group is attached to the benzene ring. This compound is typically a pale yellow to light brown liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of both the aldehyde and nitro groups, making it useful in various chemical synthesis applications, including the production of pharmaceuticals and agrochemicals. The compound's properties, such as solubility and boiling point, can vary based on environmental conditions and the presence of other functional groups. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity.

Formula: C₈H₆FNO₃

InChI: InChI=1S/C8H6FNO3/c9-8-5-7(10(12)13)2-1-6(8)3-4-11/h1-2,4-5H,3H2

InChI key: InChIKey=LZKNKPAAARBNAV-UHFFFAOYSA-N

SMILES: C(C=O)C1=C(F)C=C(N(=O)=O)C=C1

Synonyms:

• 2-Fluoro-4-nitrobenzeneacetaldehyde
• Benzeneacetaldehyde, 2-fluoro-4-nitro-
• 2-(2-Fluoro-4-nitrophenyl)acetaldehyde