CAS 1160707-44-7

1-[4-(3-Chloropropoxy)-5-methoxy-2-nitrophenyl]ethanone

Description:

1-[4-(3-Chloropropoxy)-5-methoxy-2-nitrophenyl]ethanone, with the CAS number 1160707-44-7, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with a methoxy group, a nitro group, and a chloropropoxy side chain. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in organic solvents and varying reactivity due to the presence of functional groups such as the nitro and ether functionalities. The chloropropoxy group may impart specific biological activities or interactions, making it of interest in medicinal chemistry or agrochemical applications. The presence of the nitro group can also influence the compound's electronic properties, potentially affecting its reactivity and interactions with biological targets. Overall, the characteristics of this compound suggest it may have applications in research fields that explore the synthesis of novel compounds or the development of pharmaceuticals. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise values.

Formula: C₁₂H₁₄ClNO₅

InChI: InChI=1S/C12H14ClNO5/c1-8(15)9-6-11(18-2)12(19-5-3-4-13)7-10(9)14(16)17/h6-7H,3-5H2,1-2H3

InChI key: InChIKey=HRVQZRCLRPJMQQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C(C)=O)C=C(OC)C(OCCCCl)=C1

Synonyms:

• 1-[5-Methoxy-4-(3-chloro-propoxy)-2-nitro-phenyl]-ethanone
• 1-[4-(3-Chloropropyloxy)-5-methoxy-2-nitrophenyl]ethanone
• Ethanone, 1-[4-(3-chloropropoxy)-5-methoxy-2-nitrophenyl]-
• 1-[4-(3-Chloropropoxy)-5-methoxy-2-nitrophenyl]ethanone
• 4-(3-Chloropropoxy)-5-methoxy-2-nitroacetophenone