CymitQuimica logo

CAS 1160748-34-4

:

Ethyl 3-[(2-azidoacetyl)amino]benzoate

Description:
Ethyl 3-[(2-azidoacetyl)amino]benzoate is a chemical compound characterized by its azido and ester functional groups, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The azido group is known for its ability to participate in click chemistry, facilitating the formation of triazoles through cycloaddition reactions. This compound typically exhibits moderate stability under standard conditions but may be sensitive to heat and light, which can lead to decomposition or unwanted reactions. Its structure includes a benzene ring, which imparts aromatic characteristics, influencing its electronic properties and reactivity. Ethyl 3-[(2-azidoacetyl)amino]benzoate may also exhibit biological activity, making it of interest in pharmaceutical research. However, handling precautions should be observed due to the potential hazards associated with azido compounds, which can be explosive under certain conditions.
Formula:C11H12N4O3
InChI:InChI=1S/C11H12N4O3/c1-2-18-11(17)8-4-3-5-9(6-8)14-10(16)7-13-15-12/h3-6H,2,7H2,1H3,(H,14,16)
InChI key:InChIKey=OTJCBEBNPRIZAL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(NC(CN=[N+]=[N-])=O)=CC=C1
Synonyms:
  • Benzoic acid, 3-[(2-azidoacetyl)amino]-, ethyl ester
  • Ethyl 3-[(2-azidoacetyl)amino]benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.