
CAS 1160800-42-9
:1-Oxa-8-azaspiro[4.6]undecane
Description:
1-Oxa-8-azaspiro[4.6]undecane is a chemical compound characterized by its unique spirocyclic structure, which includes both nitrogen and oxygen heteroatoms. The compound features a bicyclic framework that consists of a nitrogen atom integrated into a spiro system, contributing to its potential biological activity. The presence of the oxygen atom in the structure suggests that it may exhibit properties typical of ether or alcohol functionalities, influencing its reactivity and solubility. This compound may be of interest in medicinal chemistry due to its structural complexity, which can lead to diverse interactions with biological targets. Additionally, the spirocyclic nature often imparts rigidity to the molecule, potentially affecting its conformational dynamics and pharmacokinetic properties. As with many heterocyclic compounds, 1-Oxa-8-azaspiro[4.6]undecane may also exhibit interesting properties such as chirality, depending on its specific stereochemistry. Overall, the characteristics of this compound make it a subject of interest for further research in various fields, including drug development and materials science.
Formula:C9H17NO
InChI:InChI=1S/C9H17NO/c1-3-9(4-2-8-11-9)5-7-10-6-1/h10H,1-8H2
InChI key:InChIKey=LKODXJQTMSYTAY-UHFFFAOYSA-N
SMILES:C12(CCCO1)CCCNCC2
Synonyms:- 1-Oxa-8-azaspiro[4.6]undecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.