
CAS 116084-93-6
:1-Hydroxy-2,3-dimethoxydibenz[cd,f]indol-4(5H)-one
Description:
1-Hydroxy-2,3-dimethoxydibenz[cd,f]indol-4(5H)-one, with the CAS number 116084-93-6, is a complex organic compound characterized by its unique structure, which includes a dibenzindole framework. This compound features hydroxyl and methoxy functional groups, contributing to its chemical reactivity and potential biological activity. The presence of these functional groups often enhances solubility in organic solvents and can influence the compound's interaction with biological systems. It may exhibit properties such as fluorescence or photostability, making it of interest in various fields, including medicinal chemistry and materials science. The compound's specific applications can vary, but it may be explored for its potential therapeutic effects or as a building block in organic synthesis. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH, temperature, and solvent choice. Further studies are often required to fully elucidate its properties and potential applications.
Formula:C17H13NO4
InChI:InChI=1S/C17H13NO4/c1-21-15-13-12-10(18-17(13)20)7-8-5-3-4-6-9(8)11(12)14(19)16(15)22-2/h3-7,19H,1-2H3,(H,18,20)
InChI key:InChIKey=PHKYZFGDNGACRM-UHFFFAOYSA-N
SMILES:OC=1C2=C3C(=C(OC)C1OC)C(=O)NC3=CC=4C2=CC=CC4
Synonyms:- Dibenz[cd,f]indol-4(5H)-one, 1-hydroxy-2,3-dimethoxy-
- 1-Hydroxy-2,3-dimethoxydibenz[cd,f]indol-4(5H)-one
- 1-Hydroxy-2,3-dimethoxydibenzo[cd,f]indol-4(5H)-one
- Piperolactam B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Piperolactam D
CAS:<p>Piperolactam D is a useful organic compound for research related to life sciences. The catalog number is T126315 and the CAS number is 116084-93-6.</p>Formula:C17H13NO4Color and Shape:SolidMolecular weight:295.294
