CAS 1160993-93-0

5,6-Dimethyl-3-pyridinesulfonic acid

Description:

5,6-Dimethyl-3-pyridinesulfonic acid is an organic compound characterized by its pyridine ring structure, which is substituted at the 3-position with a sulfonic acid group and at the 5 and 6 positions with methyl groups. This compound is typically a white to off-white solid and is soluble in water due to the presence of the sulfonic acid functional group, which enhances its polarity. The sulfonic acid group imparts acidic properties, making it a strong acid compared to other organic acids. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or a reagent. Additionally, the presence of methyl groups can influence the compound's reactivity and stability, affecting its behavior in chemical reactions. As with many sulfonic acids, it may exhibit good thermal stability, making it suitable for various synthetic processes. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₇H₉NO₃S

InChI: InChI=1S/C7H9NO3S/c1-5-3-7(12(9,10)11)4-8-6(5)2/h3-4H,1-2H3,(H,9,10,11)

InChI key: InChIKey=DTILOJMMDPDHDW-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C=1C=C(C)C(C)=NC1

Synonyms:

• 5,6-Dimethyl-3-pyridinesulfonic acid
• 3-Pyridinesulfonic acid, 5,6-dimethyl-