CymitQuimica logo

CAS 1160994-75-1

:

2-Bromo-4(3H)-pyrimidinone

Description:
2-Bromo-4(3H)-pyrimidinone is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom and a keto group. The presence of the bromine atom introduces notable reactivity, making it a useful intermediate in various organic synthesis reactions. The compound features a nitrogen-containing six-membered ring, which contributes to its potential biological activity, including antimicrobial and antiviral properties. Its molecular structure allows for hydrogen bonding, influencing its solubility and interaction with other molecules. Typically, compounds like 2-Bromo-4(3H)-pyrimidinone are utilized in medicinal chemistry and drug development due to their ability to act as building blocks for more complex molecules. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, 2-Bromo-4(3H)-pyrimidinone represents a significant class of compounds in pharmaceutical research and development.
Formula:C4H3BrN2O
InChI:InChI=1S/C4H3BrN2O/c5-4-6-2-1-3(8)7-4/h1-2H,(H,6,7,8)
InChI key:InChIKey=PCXCYBRMVAQGAJ-UHFFFAOYSA-N
SMILES:O=C1NC(Br)=NC=C1
Synonyms:
  • 4(3H)-Pyrimidinone, 2-bromo-
  • 2-Bromo-4(3H)-pyrimidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.