CAS 1160994-80-8

Methyl N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N-methylcarbamate

Description:

Methyl N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N-methylcarbamate, identified by its CAS number 1160994-80-8, is a chemical compound that belongs to the class of carbamates. This substance features a pyridine ring substituted with a chlorine atom and a trifluoromethyl group, which contributes to its unique chemical properties. The presence of these functional groups often enhances the compound's biological activity and lipophilicity. As a carbamate, it is characterized by the presence of a carbamate functional group (-NH-CO-O-), which is known for its applications in agriculture as a pesticide or herbicide. The compound's molecular structure suggests potential interactions with biological systems, making it of interest in pharmacology and agrochemistry. Additionally, the trifluoromethyl group is known to influence the compound's stability and reactivity. Overall, this compound's specific characteristics, including its solubility, stability, and reactivity, would depend on its molecular interactions and the environment in which it is used.

Formula: C₉H₈ClF₃N₂O₂

InChI: InChI=1S/C9H8ClF3N2O2/c1-15(8(16)17-2)7-4-5(9(11,12)13)3-6(10)14-7/h3-4H,1-2H3

InChI key: InChIKey=BXYMWBXEUKAPIV-UHFFFAOYSA-N

SMILES: N(C(OC)=O)(C)C1=CC(C(F)(F)F)=CC(Cl)=N1

Synonyms:

• Carbamic acid, N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N-methyl-, methyl ester
• Methyl N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N-methylcarbamate

Methyl (6-chloro-4-(trifluoromethyl)pyridin-2-ylmethylcarbamate

CAS: 1160994-80-8

Formula: C₉H₈ClF₃N₂O₂

Purity: 95.0%

Molecular weight: 268.62

Ref: 10-F316551