CAS 1160995-04-9: Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-indole-3-carboxylate

Description: Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-indole-3-carboxylate is a chemical compound characterized by its complex structure, which includes an indole ring, an ethyl ester group, and a dimethylethoxycarbonyl moiety. This compound is typically classified as an indole derivative, which is significant in medicinal chemistry due to the diverse biological activities associated with indole-based compounds. The presence of the ethyl ester group suggests that it may exhibit properties related to esterification, such as solubility in organic solvents and potential reactivity in various chemical reactions. The dimethylethoxycarbonyl group can influence the compound's stability and reactivity, making it a useful intermediate in organic synthesis. Additionally, the amino group in the structure may contribute to its potential as a pharmacophore, allowing for interactions with biological targets. Overall, this compound's unique structural features may render it of interest in drug development and synthetic chemistry, although specific applications would depend on further research and characterization.

Formula: C₁₆H₂₀N₂O₄

InChI: InChI=1S/C16H20N2O4/c1-5-21-14(19)12-10-8-6-7-9-11(10)17-13(12)18-15(20)22-16(2,3)4/h6-9,17H,5H2,1-4H3,(H,18,20)

InChI key: InChIKey=UQCCBKFSBGPNMA-UHFFFAOYSA-N

SMILES: O=C(OC(C)(C)C)NC=1NC=2C=CC=CC2C1C(=O)OCC

Synonyms:

• 1H-Indole-3-carboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, ethyl ester
• Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-indole-3-carboxylate

1H-Indole-3-carboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, ethyl ester

CAS: 1160995-04-9

• Formula: C₁₆H₂₀N₂O₄
• Molecular weight: 304.3410

Ethyl 2-((tert-butoxycarbonyl)amino)-1h-indole-3-carboxylate

CAS: 1160995-04-9

• Molecular weight: 304.34g/mol

Ethyl 2-((tert-butoxycarbonyl)amino)-1H-indole-3-carboxylate

CAS: 1160995-04-9

• Purity: 95+%
• Molecular weight: 304.34600830078125