CAS 1160995-23-2

6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine

Description:

6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine is a heterocyclic compound characterized by its complex fused ring structure, which incorporates both pyrrole and triazine moieties. This compound features bromine and chlorine substituents, which can significantly influence its chemical reactivity and physical properties. Typically, such halogenated compounds exhibit enhanced stability and may possess interesting electronic properties due to the presence of electronegative halogens. The presence of multiple halogens can also affect solubility, boiling and melting points, and reactivity towards nucleophiles. Additionally, the unique structure of this compound may confer specific biological activities, making it of interest in pharmaceutical and agrochemical research. Its synthesis and characterization often involve advanced organic chemistry techniques, and it may serve as a precursor or intermediate in the development of more complex chemical entities. Overall, 6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine represents a valuable compound in the field of synthetic chemistry and materials science.

Formula: C₆H₂BrCl₂N₃

InChI: InChI=1S/C6H2BrCl2N3/c7-3-1-4-5(8)10-6(9)11-12(4)2-3/h1-2H

InChI key: InChIKey=NRVGOQKEQWXMOO-UHFFFAOYSA-N

SMILES: ClC=1C=2N(C=C(Br)C2)N=C(Cl)N1

Synonyms:

• 6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine
• Pyrrolo[2,1-f][1,2,4]triazine, 6-bromo-2,4-dichloro-

Pyrrolo[2,1-f][1,2,4]triazine, 6-bromo-2,4-dichloro-

CAS: 1160995-23-2

Formula: C₆H₂BrCl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 266.9102

Ref: IN-DA000BMK

6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine

CAS: 1160995-23-2

6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine

Purity: 98%

Molecular weight: 266.91g/mol

Ref: 54-OR1060139

6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine

CAS: 1160995-23-2

Formula: C₆H₂BrCl₂N₃

Purity: 98%

Molecular weight: 266.91

Ref: 10-F516927