
CAS 116106-17-3
:2-Furancarbonyl chloride, 3,5-dichloro-
Description:
2-Furancarbonyl chloride, 3,5-dichloro- is an organic compound characterized by the presence of a furan ring, which is a five-membered aromatic heterocycle containing oxygen. The compound features a carbonyl chloride functional group, indicating the presence of a carbonyl (C=O) bonded to a chlorine atom. The 3,5-dichloro substitution on the furan ring introduces two chlorine atoms at the 3 and 5 positions, enhancing its reactivity and potentially influencing its physical properties. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. It may exhibit properties such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. Additionally, due to the presence of the carbonyl chloride group, it is likely to be reactive, particularly with nucleophiles, and may require careful handling due to its potential to release hydrochloric acid upon hydrolysis. Safety precautions should be observed when working with this compound, as it may pose health hazards.
Formula:C5HCl3O2
InChI:InChI=1S/C5HCl3O2/c6-2-1-3(7)10-4(2)5(8)9/h1H
InChI key:InChIKey=KCHJLRPMDJQSPC-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1OC(Cl)=CC1Cl
Synonyms:- 2-Furoyl chloride, 3,5-dichloro-
- 2-Furancarbonyl chloride, 3,5-dichloro-
- 3,5-Dichlorofuran-2-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
