CAS 116112-99-3
:2-cyclohexyl-5-methyl-1,3-thiazolidine
Description:
2-Cyclohexyl-5-methyl-1,3-thiazolidine is a heterocyclic organic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms. The thiazolidine structure features a thiazolidine ring, which is a saturated ring containing a sulfur atom and a nitrogen atom, contributing to its unique chemical properties. The presence of the cyclohexyl group provides hydrophobic characteristics, while the methyl group enhances its reactivity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with various biological targets, which could lead to pharmacological applications. Additionally, the compound's stability and reactivity can be influenced by the substituents on the ring, affecting its behavior in chemical reactions. Overall, 2-cyclohexyl-5-methyl-1,3-thiazolidine is a compound of interest due to its structural features and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H19NS
InChI:InChI=1/C10H19NS/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h8-11H,2-7H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
