CymitQuimica logo

CAS 116113-07-6

:

3-(5-methyl-1,3-thiazolidin-2-yl)pyridine

Description:
3-(5-Methyl-1,3-thiazolidin-2-yl)pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a thiazolidine moiety. The presence of the thiazolidine ring, which contains sulfur and nitrogen, contributes to its potential biological activity and reactivity. This compound typically exhibits moderate polarity due to the functional groups present, influencing its solubility in various solvents. It may participate in hydrogen bonding due to the nitrogen and sulfur atoms, affecting its interactions in biological systems. The methyl group on the thiazolidine ring can influence the steric and electronic properties of the molecule, potentially impacting its pharmacological profile. Compounds of this nature are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C9H12N2S
InChI:InChI=1/C9H12N2S/c1-7-5-11-9(12-7)8-3-2-4-10-6-8/h2-4,6-7,9,11H,5H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.