CAS 116129-03-4

Methyl cis-1-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)cyclobutanecarboxylate

Description:

Methyl cis-1-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)cyclobutanecarboxylate, with the CAS number 116129-03-4, is a chemical compound characterized by its complex structure, which includes a cyclobutane ring and various functional groups. This compound features a methyl ester group, an amino group, and a hydroxymethyl substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the dimethylethoxycarbonyl group suggests that it may be involved in protective strategies for amines in synthetic pathways. Its cis configuration indicates specific stereochemistry, which can influence its biological activity and interactions. The compound is likely to exhibit moderate solubility in organic solvents due to its ester and hydroxyl functionalities. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules, although specific applications would depend on further research and characterization.

Formula: C₁₂H₂₁NO₅

InChI: InChI=1/C12H21NO5/c1-11(2,3)18-10(16)13-12(9(15)17-4)5-8(6-12)7-14/h8,14H,5-7H2,1-4H3,(H,13,16)/t8-,12+

InChI key: InChIKey=JWUKOWKUAPSHEH-LYWQIFSTNA-N

SMILES: N(C(OC(C)(C)C)=O)[C@@]1(C(OC)=O)C[C@@H](CO)C1

Synonyms:

• Cyclobutanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)-, methyl ester, cis-
• Methyl cis-1-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)cyclobutanecarboxylate

Cyclobutanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(hydroxymethyl)-, methyl ester, cis-

CAS: 116129-03-4

Formula: C₁₂H₂₁NO₅

Purity: 97%

Molecular weight: 259.2988

Ref: IN-DA01R2XK