CAS 116140-15-9
:4-Methylpiperidine-3-carboxylic acid
Description:
4-Methylpiperidine-3-carboxylic acid is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a methyl group at the 4-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. It has potential applications in pharmaceuticals and organic synthesis, particularly as an intermediate in the production of various bioactive compounds. The carboxylic acid functionality allows for further derivatization, making it a versatile building block in chemical synthesis. Additionally, the nitrogen atom in the piperidine ring can participate in various chemical reactions, enhancing its utility in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-5-2-3-8-4-6(5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)
InChI key:InChIKey=WKOFYEXTIWYYNM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(C)CCNC1
Synonyms:- 3-Piperidinecarboxylic acid, 4-methyl-
- 4-Methyl-3-piperidinecarboxylic acid
- 4-Methylpiperidine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
