
CAS 116140-32-0
:6-Phenyl-3-piperidinecarboxylic acid
Description:
6-Phenyl-3-piperidinecarboxylic acid is an organic compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. The presence of a phenyl group at the 6-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, while the phenyl group may enhance its lipophilicity. It can participate in various chemical reactions, including esterification and amidation, due to the reactive carboxylic acid moiety. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could lead to pharmacological applications. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 6-Phenyl-3-piperidinecarboxylic acid would depend on its concentration and exposure conditions.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c14-12(15)10-6-7-11(13-8-10)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2,(H,14,15)
InChI key:InChIKey=UJTBCSSYKUVVKH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCC(NC1)C2=CC=CC=C2
Synonyms:- 6-Phenyl-3-piperidinecarboxylic acid
- 3-Piperidinecarboxylic acid, 6-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.