CAS 116161-01-4
:1,3-Diethynyl-1,1,2,2,3,3-hexamethyltrisilane
Description:
1,3-Diethynyl-1,1,2,2,3,3-hexamethyltrisilane is an organosilicon compound characterized by its unique structure, which includes a trisilane backbone and ethynyl functional groups. The presence of three silicon atoms connected by single bonds, along with multiple methyl groups, contributes to its stability and hydrophobic properties. The ethynyl groups introduce reactivity, making the compound useful in various synthetic applications, particularly in materials science and organic synthesis. This compound is typically colorless to pale yellow and may exhibit a low volatility. Its chemical properties are influenced by the silicon-silicon and silicon-carbon bonds, which can participate in cross-linking reactions. Additionally, the compound's structure allows for potential applications in the development of silicone-based materials, coatings, and as intermediates in organic synthesis. Safety data should be consulted for handling, as organosilicon compounds can vary in toxicity and reactivity. Overall, 1,3-Diethynyl-1,1,2,2,3,3-hexamethyltrisilane is notable for its combination of silicon chemistry and functional group versatility.
Formula:C10H20Si3
InChI:InChI=1S/C10H20Si3/c1-9-11(3,4)13(7,8)12(5,6)10-2/h1-2H,3-8H3
InChI key:InChIKey=OWLFEQWAPYOAMR-UHFFFAOYSA-N
SMILES:[Si]([Si](C#C)(C)C)([Si](C#C)(C)C)(C)C
Synonyms:- Trisilane, 1,3-diethynyl-1,1,2,2,3,3-hexamethyl-
- 1,3-Diethynyl-1,1,2,2,3,3-hexamethyltrisilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
