CAS 116162-91-5
:1-tert-butyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid
Description:
1-tert-butyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a naphthyridine core, a tert-butyl group, and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, and its functional groups contribute to its potential biological activity. The presence of the fluoro substituent may enhance lipophilicity and influence the compound's interaction with biological targets. As a carboxylic acid, it can participate in acid-base reactions and may form salts or esters. The piperazine ring is known for its role in pharmacology, often contributing to the compound's activity as a potential therapeutic agent. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of new pharmaceuticals targeting various biological pathways. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C17H21FN4O3
InChI:InChI=1/C17H21FN4O3/c1-17(2,3)22-9-11(16(24)25)13(23)10-8-12(18)15(20-14(10)22)21-6-4-19-5-7-21/h8-9,19H,4-7H2,1-3H3,(H,24,25)
SMILES:CC(C)(C)n1cc(c(=O)c2cc(c(nc12)N1CCNCC1)F)C(=O)O
Synonyms:- 1,8-Naphthyridine-3-Carboxylic Acid, 1-(1,1-Dimethylethyl)-6-Fluoro-1,4-Dihydro-4-Oxo-7-(1-Piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,8-Naphthyridine-3-carboxylic acid, 1-(1,1-dimethylethyl)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-
CAS:Formula:C17H21FN4O3Molecular weight:348.372
