CymitQuimica logo

CAS 116162-95-9

:

1-tert-Butyl-6-fluoro-7-(-3-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-[ 1,8]naphthyridine-3-carboxylic acid

Description:
1-tert-Butyl-6-fluoro-7-(3-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a naphthyridine core, a tert-butyl group, and a fluorine atom. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a piperazine moiety suggests potential biological activity, as piperazine derivatives are often associated with pharmacological effects. The fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular architecture. As with many compounds in this class, it may exhibit interesting properties such as antimicrobial or antiviral activity, making it a candidate for further research in drug development. Safety and handling precautions should be observed due to its chemical nature.
Formula:C18H23FN4O3
InChI:InChI=1/C18H23FN4O3/c1-10-8-22(6-5-20-10)16-13(19)7-11-14(24)12(17(25)26)9-23(15(11)21-16)18(2,3)4/h7,9-10,20H,5-6,8H2,1-4H3,(H,25,26)
SMILES:CC1CN(CCN1)c1c(cc2c(=O)c(cn(c2n1)C(C)(C)C)C(=O)O)F
Synonyms:
  • Pd 163048
  • 1-tert-Butyl-6-fluoro-7-(-3-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-(1,8)naphthyridine-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.