CymitQuimica logo

CAS 116163-02-1

:

1-tert-Butyl-6-fluoro-7-(3-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-qu inoline-3-carboxylic acid

Description:
1-tert-Butyl-6-fluoro-7-(3-methyl-piperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, with the CAS number 116163-02-1, is a synthetic organic compound characterized by its complex structure, which includes a quinoline core. This compound features a tert-butyl group and a fluorine atom, contributing to its lipophilicity and potential biological activity. The presence of a carboxylic acid functional group suggests it may exhibit acidic properties, influencing its solubility and reactivity in various environments. Additionally, the 3-methyl-piperazine moiety may enhance its pharmacological profile, potentially allowing for interactions with biological targets. The compound's unique structural features may make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its stability, solubility, and reactivity would depend on the specific conditions, such as pH and solvent, making it essential to consider these factors in practical applications. Overall, this compound represents a class of derivatives that could have significant implications in drug discovery and development.
Formula:C19H24FN3O3
InChI:InChI=1/C19H24FN3O3/c1-11-9-22(6-5-21-11)16-8-15-12(7-14(16)20)17(24)13(18(25)26)10-23(15)19(2,3)4/h7-8,10-11,21H,5-6,9H2,1-4H3,(H,25,26)
SMILES:CC1CN(CCN1)c1cc2c(cc1F)c(=O)c(cn2C(C)(C)C)C(=O)O
Synonyms:
  • 1-tert-Butyl-6-fluoro-7-(3-methyl-piperazin-1-yl)-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid
  • Pd 161314
  • Pd161314
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.