CymitQuimica logo

CAS 116163-98-5

:

2-Bromo-1,4-dibutoxybenzene

Description:
2-Bromo-1,4-dibutoxybenzene is an organic compound characterized by the presence of a bromine atom and two butoxy groups attached to a benzene ring. The bromine substituent is located at the second position, while the butoxy groups are positioned at the first and fourth positions of the aromatic ring, making it a derivative of dibutoxybenzene. This compound typically exhibits a moderate level of hydrophobicity due to the long butoxy chains, which can influence its solubility in organic solvents. The presence of the bromine atom can also impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit interesting physical properties such as melting and boiling points that are influenced by the bulky butoxy groups. Its applications may extend to fields such as materials science, organic synthesis, and potentially in the development of pharmaceuticals or agrochemicals, depending on its reactivity and functional properties. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C14H21BrO2
InChI:InChI=1S/C14H21BrO2/c1-3-5-9-16-12-7-8-14(13(15)11-12)17-10-6-4-2/h7-8,11H,3-6,9-10H2,1-2H3
InChI key:InChIKey=PEHIGRGBDNMEKW-UHFFFAOYSA-N
SMILES:O(CCCC)C1=C(Br)C=C(OCCCC)C=C1
Synonyms:
  • 1,4-Bis(butoxy)-2-bromobenzene
  • Benzene, 2-bromo-1,4-dibutoxy-
  • 2,5-Dibutoxybromobenzene
  • 2-Bromo-1,4-dibutoxybenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.