CAS 116169-14-3
:5'-O-(cellobiosyl)pyridoxine
Description:
5'-O-(Cellobiosyl)pyridoxine, with the CAS number 116169-14-3, is a glycosylated form of pyridoxine, commonly known as vitamin B6. This compound features a cellobiosyl group, which is a disaccharide composed of two glucose units linked by a β-1,4-glycosidic bond, attached to the 5' position of the pyridoxine molecule. The presence of the cellobiosyl moiety enhances the solubility and stability of pyridoxine, potentially influencing its bioavailability and metabolic pathways. As a derivative of vitamin B6, it retains the essential biological functions associated with pyridoxine, including its role as a coenzyme in amino acid metabolism and neurotransmitter synthesis. The compound may exhibit unique properties in terms of its interaction with biological systems, making it of interest in nutritional and pharmaceutical research. Its structural characteristics, including molecular weight and functional groups, contribute to its reactivity and potential applications in various fields, including biochemistry and medicinal chemistry.
Formula:C20H31NO13
InChI:InChI=1/C20H31NO13/c1-7-12(25)9(3-22)8(2-21-7)6-31-19-17(30)15(28)18(11(5-24)33-19)34-20-16(29)14(27)13(26)10(4-23)32-20/h2,10-11,13-20,22-30H,3-6H2,1H3/t10-,11-,13-,14+,15-,16-,17-,18-,19-,20+/m1/s1
Synonyms:- [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl 4-O-beta-D-glucopyranosyl-beta-D-glucopyranoside
- 5-Cbpd
- 5'-O-(Cellobiosyl)pyridoxine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5'-O-(Cellobiosyl)pyridoxine
CAS:Controlled ProductFormula:C20H31NO13Color and Shape:NeatMolecular weight:493.459

