
CAS 116169-51-8
:rel-(3R,4S)-4-Phenyl-3-pyrrolidinamine
Description:
Rel-(3R,4S)-4-Phenyl-3-pyrrolidinamine is a chiral organic compound characterized by its specific stereochemistry, which is crucial for its biological activity. The compound features a pyrrolidine ring, a five-membered nitrogen-containing heterocycle, which contributes to its basicity and potential interactions with biological targets. The presence of a phenyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. This compound may exhibit properties typical of amines, such as forming salts with acids and participating in hydrogen bonding. Its stereochemical configuration (3R,4S) suggests that it may have distinct pharmacological properties compared to its enantiomers, making it of interest in medicinal chemistry. The compound's CAS number, 116169-51-8, allows for precise identification in chemical databases, facilitating research and development in various applications, including pharmaceuticals. Overall, rel-(3R,4S)-4-Phenyl-3-pyrrolidinamine is a compound of interest due to its structural features and potential biological implications.
Formula:C10H14N2
InChI:InChI=1/C10H14N2/c11-10-7-12-6-9(10)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7,11H2/t9-,10+/s2
InChI key:InChIKey=STVJPRMSEZRNNG-NLJMKPLXNA-N
SMILES:N[C@H]1[C@@H](CNC1)C2=CC=CC=C2
Synonyms:- rel-(3R,4S)-4-Phenyl-3-pyrrolidinamine
- 3-Pyrrolidinamine, 4-phenyl-, trans-
- 3-Pyrrolidinamine, 4-phenyl-, (3R,4S)-rel-
- trans-4-Phenyl-3-pyrrolidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.