
CAS 116169-52-9
:3-Pyrrolidinemethanamine, 4-phenyl-1-(phenylmethyl)-, trans-
Description:
3-Pyrrolidinemethanamine, 4-phenyl-1-(phenylmethyl)-, trans- is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a phenyl group. This compound is classified as an amine due to the presence of an amine functional group (-NH2) attached to a pyrrolidine moiety. The trans configuration indicates that specific substituents are oriented in a way that minimizes steric hindrance, which can influence its reactivity and interactions with biological systems. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The compound may exhibit properties such as solubility in organic solvents and varying degrees of stability depending on environmental conditions. As with many amines, it may also participate in hydrogen bonding, affecting its physical properties and biological activity. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C18H22N2
InChI:InChI=1/C18H22N2/c19-11-17-13-20(12-15-7-3-1-4-8-15)14-18(17)16-9-5-2-6-10-16/h1-10,17-18H,11-14,19H2/t17-,18+/s2
InChI key:InChIKey=KAXQIIGCHQPXCF-ZVOYONDMNA-N
SMILES:C(N)[C@H]1[C@@H](CN(CC2=CC=CC=C2)C1)C3=CC=CC=C3
Synonyms:- 3-Pyrrolidinemethanamine, 4-phenyl-1-(phenylmethyl)-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.