CymitQuimica logo

CAS 116173-69-4

:

Carbamic acid, (1-methoxy-3-butenyl)-, methyl ester

Description:
Carbamic acid, (1-methoxy-3-butenyl)-, methyl ester, with the CAS number 116173-69-4, is an organic compound that belongs to the class of carbamates. This substance features a methoxy group and a butenyl chain, which contribute to its unique chemical properties. It is typically characterized by its moderate polarity due to the presence of both ester and amine functional groups. The compound may exhibit a range of reactivity, particularly in nucleophilic substitution reactions, owing to the carbamate structure. Its molecular structure suggests potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. Additionally, the presence of the methoxy group may enhance its solubility in organic solvents. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with exposure or environmental impact. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to basic chemical frameworks.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-4-5-6(10-2)8-7(9)11-3/h4,6H,1,5H2,2-3H3,(H,8,9)
InChI key:InChIKey=YAGDMUZDKSVXGW-UHFFFAOYSA-N
SMILES:C(NC(OC)=O)(CC=C)OC
Synonyms:
  • Carbamic acid, (1-methoxy-3-butenyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.