
CAS 1161737-36-5
:4,5-Dihydro-4-hydroxy-5,5,6-trimethyl-3(2H)-pyridazinone
Description:
4,5-Dihydro-4-hydroxy-5,5,6-trimethyl-3(2H)-pyridazinone, with the CAS number 1161737-36-5, is a heterocyclic organic compound characterized by its pyridazinone structure, which includes a pyridazine ring with additional functional groups. This compound features a dihydro form, indicating the presence of two hydrogen atoms that contribute to its saturation. The hydroxyl group (-OH) at the 4-position enhances its polarity and potential for hydrogen bonding, which can influence its solubility and reactivity. The presence of three methyl groups at the 5 and 6 positions contributes to its hydrophobic character and steric bulk, potentially affecting its biological activity and interactions with other molecules. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can lead to unique chemical behavior, including reactivity in various organic reactions. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C7H12N2O2
InChI:InChI=1S/C7H12N2O2/c1-4-7(2,3)5(10)6(11)9-8-4/h5,10H,1-3H3,(H,9,11)
InChI key:InChIKey=SOKGADDJVFMMNQ-UHFFFAOYSA-N
SMILES:OC1C(C)(C)C(C)=NNC1=O
Synonyms:- 4-Hydroxy-5,5,6-trimethyl-4,5-dihydro-2H-pyridazin-3-one
- 3(2H)-Pyridazinone, 4,5-dihydro-4-hydroxy-5,5,6-trimethyl-
- 4,5-Dihydro-4-hydroxy-5,5,6-trimethyl-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3(2H)-Pyridazinone, 4,5-dihydro-4-hydroxy-5,5,6-trimethyl-
CAS:Formula:C7H12N2O2Molecular weight:156.1824
