CymitQuimica logo

CAS 116174-37-9

:

1-Benzoyloctahydro-1H-indole-2-carbonitrile

Description:
1-Benzoyloctahydro-1H-indole-2-carbonitrile is a chemical compound characterized by its complex structure, which includes an indole moiety fused with a cyclohexane ring, along with a benzoyl group and a cyano group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the cyano group suggests potential for nucleophilic reactions, while the benzoyl group may enhance its stability and influence its electronic properties. Additionally, the octahydro structure indicates a saturated framework, which can affect the compound's physical properties, such as melting and boiling points. This compound may be of interest in pharmaceutical research due to its structural features, which could be relevant for drug design and development. However, specific applications and biological activities would require further investigation through empirical studies. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C16H18N2O
InChI:InChI=1S/C16H18N2O/c17-11-14-10-13-8-4-5-9-15(13)18(14)16(19)12-6-2-1-3-7-12/h1-3,6-7,13-15H,4-5,8-10H2
InChI key:InChIKey=HTTRFBGFJUMOKF-UHFFFAOYSA-N
SMILES:C(=O)(N1C2C(CC1C#N)CCCC2)C3=CC=CC=C3
Synonyms:
  • 1H-Indole-2-carbonitrile, 1-benzoyloctahydro-
  • 1-Benzoyloctahydro-1H-indole-2-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.