
CAS 116174-40-4
:(1S,2S)-2-(Hydroxymethyl)cyclohexanecarboxamide
Description:
(1S,2S)-2-(Hydroxymethyl)cyclohexanecarboxamide is a chemical compound characterized by its cyclohexane ring structure, which features a hydroxymethyl group and a carboxamide functional group. The stereochemistry indicated by (1S,2S) denotes specific spatial arrangements of the substituents around the chiral centers, which can influence the compound's reactivity and interactions. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the hydroxymethyl and amide groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of biologically active molecules. The presence of the hydroxymethyl group may also enhance its reactivity in various chemical reactions, making it a versatile intermediate in synthetic chemistry. As with many organic compounds, safety data should be consulted for handling and storage, as well as potential environmental impacts.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c9-8(11)7-4-2-1-3-6(7)5-10/h6-7,10H,1-5H2,(H2,9,11)/t6-,7+/m1/s1
InChI key:InChIKey=OEVOZNQMEGBPOA-RQJHMYQMSA-N
SMILES:C(O)[C@@H]1[C@@H](C(N)=O)CCCC1
Synonyms:- (1S,2S)-2-(Hydroxymethyl)cyclohexanecarboxamide
- Cyclohexanecarboxamide, 2-(hydroxymethyl)-, (1S-trans)-
- Cyclohexanecarboxamide, 2-(hydroxymethyl)-, (1S,2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
