
CAS 116182-44-6
:Nonanoic acid, 9-[[4-[hexahydro-3,8-dihydroxy-2-(2-hydroxy-1-methylpropyl)-2H,5H-pyrano[4,3-b]pyran-7-yl]-3-methyl-1-oxo-2-butenyl]oxy]-, monosodium salt, [2R-[2α(1S*,2S*),3β,4aα,7β(E),8α,8aβ]]-
Description:
Nonanoic acid, specifically the compound with the provided name and CAS number 116182-44-6, is a complex chemical structure characterized by its long carbon chain and functional groups that contribute to its properties. As a fatty acid, it features a nonane backbone, which typically imparts hydrophobic characteristics, while the presence of a sodium salt indicates its solubility in water, enhancing its potential applications in various formulations. The intricate structure includes multiple hydroxyl groups and a pyran ring, suggesting potential for hydrogen bonding and reactivity, which may influence its biological activity and interaction with other molecules. This compound may exhibit surfactant properties due to its amphiphilic nature, making it useful in emulsification processes. Additionally, the stereochemistry indicated by the specific configuration of its chiral centers suggests that it may have distinct biological effects, potentially relevant in pharmaceutical or agricultural applications. Overall, the unique combination of hydrophobic and hydrophilic characteristics, along with its structural complexity, makes this compound of interest in various scientific fields.
Formula:C26H44O9·Na
InChI:InChI=1S/C26H44O9.Na/c1-16(13-23(31)33-11-9-7-5-4-6-8-10-22(29)30)12-21-24(32)26-19(15-34-21)14-20(28)25(35-26)17(2)18(3)27;/h13,17-21,24-28,32H,4-12,14-15H2,1-3H3,(H,29,30);/b16-13+;/t17-,18-,19-,20-,21-,24-,25+,26+;/m0./s1
InChI key:InChIKey=SQSSXIHTIVZMNI-WENNQWSDSA-N
SMILES:O[C@@H]1[C@]2([C@@](C[C@H](O)[C@@]([C@H]([C@H](C)O)C)(O2)[H])(CO[C@H]1C/C(=C/C(OCCCCCCCCC(O)=O)=O)/C)[H])[H].[Na]
Synonyms:- Nonanoic acid, 9-[[4-[hexahydro-3,8-dihydroxy-2-(2-hydroxy-1-methylpropyl)-2H,5H-pyrano[4,3-b]pyran-7-yl]-3-methyl-1-oxo-2-butenyl]oxy]-, monosodium salt, [2R-[2α(1S*,2S*),3β,4aα,7β(E),8α,8aβ]]-
- 2H,5H-Pyrano[4,3-b]pyran, nonanoic acid deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2H,5H-Pyrano[4,3-b]pyranyl Mupirocin Sodium Impurity
CAS:Controlled ProductImpurity Mupirocin EP Impurity E
Stability Hygroscopic
Applications Mupirocin (M794000) impurity. The rearrangement isomer of Mupirocin is prepared using an enzyme-catalyzed, selective deesterification.
References Sime, J.T., et al.: Tetrahedron Lett., 28, 5169 (1987),Formula:C26H43O9·NaColor and Shape:Off WhiteMolecular weight:522.62H,5H-Pyrano[4,3-b]pyranyl mupirocin sodium impurity
CAS:2H,5H-Pyrano[4,3-b]pyranyl mupirocin sodium impurity is an impurity standard that has been custom synthesized for research and development purposes. It has a CAS number of 116182-44-6, which is the same as the parent compound. 2H,5H-Pyrano[4,3-b]pyranyl mupirocin sodium impurity is a metabolite of Mupirocin Sodium (CAS No. 99765-92-8). This impurity has been used in pharmacopoeia drug development and for analytical studies such as HPLC.Formula:C26H43NaO9Purity:Min. 95%Color and Shape:PowderMolecular weight:522.6 g/mol

